C18H16Br2ClN3O2 — CID 136802230
2-(2,6-dibromo-4-chloroanilino)-N-[(Z)-(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]acetamide (PubChem CID 136802230) has the molecular formula C18H16Br2ClN3O2 and a molecular weight of 501.61 g/mol. Its IUPAC name is 2-(2,6-dibromo-4-chloroanilino)-N-[(Z)-(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2,6-dibromo-4-chloroanilino)-N-[(Z)-(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 136802230 |
| Molecular Formula | C18H16Br2ClN3O2 |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 498.93 |
| IUPAC Name | 2-(2,6-dibromo-4-chloroanilino)-N-[(Z)-(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]acetamide |
| SMILES | C=CCc1cccc(/C=N\NC(=O)CNc2c(Br)cc(Cl)cc2Br)c1O |
| InChI | InChI=1S/C18H16Br2ClN3O2/c1-2-4-11-5-3-6-12(18(11)26)9-23-24-16(25)10-22-17-14(19)7-13(21)8-15(17)20/h2-3,5-9,22,26H,1,4,10H2,(H,24,25)/b23-9- |
| InChIKey | DFNCJQRJUXTYPS-AQHIEDMUSA-N |
| XLogP | 4.86 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|