C17H14Br2N2O3 — CID 2180490
3,5-dibromo-2-hydroxy-N-[(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]benzamide (PubChem CID 2180490) has the molecular formula C17H14Br2N2O3 and a molecular weight of 454.12 g/mol. Its IUPAC name is 3,5-dibromo-2-hydroxy-N-[(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]benzamide.
| Compound Name | 3,5-dibromo-2-hydroxy-N-[(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 2180490 |
| Molecular Formula | C17H14Br2N2O3 |
| Molecular Weight | 454.12 g/mol |
| Exact Mass | 451.94 |
| IUPAC Name | 3,5-dibromo-2-hydroxy-N-[(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]benzamide |
| SMILES | C=CCc1cccc(C=NNC(=O)c2cc(Br)cc(Br)c2O)c1O |
| InChI | InChI=1S/C17H14Br2N2O3/c1-2-4-10-5-3-6-11(15(10)22)9-20-21-17(24)13-7-12(18)8-14(19)16(13)23/h2-3,5-9,22-23H,1,4H2,(H,21,24) |
| InChIKey | GNUNOOSMMPTLCW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.12 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|