C14H13BrN4O2 — CID 600326
4-bromo-N-[(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]-1H-pyrazole-5-carboxamide (PubChem CID 600326) has the molecular formula C14H13BrN4O2 and a molecular weight of 349.19 g/mol. Its IUPAC name is 4-bromo-N-[(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]-1H-pyrazole-5-carboxamide.
| Compound Name | 4-bromo-N-[(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 600326 |
| Molecular Formula | C14H13BrN4O2 |
| Molecular Weight | 349.19 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 4-bromo-N-[(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]-1H-pyrazole-5-carboxamide |
| SMILES | C=CCc1cccc(C=NNC(=O)c2[nH]ncc2Br)c1O |
| InChI | InChI=1S/C14H13BrN4O2/c1-2-4-9-5-3-6-10(13(9)20)7-16-19-14(21)12-11(15)8-17-18-12/h2-3,5-8,20H,1,4H2,(H,17,18)(H,19,21) |
| InChIKey | UBFHZSUMYPVISI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.19 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|