C17H12Br2I2N2O2 — CID 99676195
3,5-dibromo-N-[(Z)-(3,5-diiodo-4-prop-2-enylphenyl)methylideneamino]-2-hydroxybenzamide (PubChem CID 99676195) has the molecular formula C17H12Br2I2N2O2 and a molecular weight of 689.91 g/mol. Its IUPAC name is 3,5-dibromo-N-[(Z)-(3,5-diiodo-4-prop-2-enylphenyl)methylideneamino]-2-hydroxybenzamide.
| Compound Name | 3,5-dibromo-N-[(Z)-(3,5-diiodo-4-prop-2-enylphenyl)methylideneamino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 99676195 |
| Molecular Formula | C17H12Br2I2N2O2 |
| Molecular Weight | 689.91 g/mol |
| Exact Mass | 687.74 |
| IUPAC Name | 3,5-dibromo-N-[(Z)-(3,5-diiodo-4-prop-2-enylphenyl)methylideneamino]-2-hydroxybenzamide |
| SMILES | C=CCc1c(I)cc(/C=N\NC(=O)c2cc(Br)cc(Br)c2O)cc1I |
| InChI | InChI=1S/C17H12Br2I2N2O2/c1-2-3-11-14(20)4-9(5-15(11)21)8-22-23-17(25)12-6-10(18)7-13(19)16(12)24/h2,4-8,24H,1,3H2,(H,23,25)/b22-8- |
| InChIKey | IYFLTPCCLWPYLN-UYOCIXKTSA-N |
| XLogP | 5.62 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.91 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|