C14H9Br2N3O4 — CID 5331629
3,5-dibromo-2-hydroxy-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide (PubChem CID 5331629) has the molecular formula C14H9Br2N3O4 and a molecular weight of 443.05 g/mol. Its IUPAC name is 3,5-dibromo-2-hydroxy-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide.
| Compound Name | 3,5-dibromo-2-hydroxy-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 5331629 |
| Molecular Formula | C14H9Br2N3O4 |
| Molecular Weight | 443.05 g/mol |
| Exact Mass | 440.90 |
| IUPAC Name | 3,5-dibromo-2-hydroxy-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1ccc([N+](=O)[O-])cc1)c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C14H9Br2N3O4/c15-9-5-11(13(20)12(16)6-9)14(21)18-17-7-8-1-3-10(4-2-8)19(22)23/h1-7,20H,(H,18,21)/b17-7+ |
| InChIKey | UNETXTNGNXAUMH-REZTVBANSA-N |
| XLogP | 3.59 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.05 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|