C16H14Br3N3O4 — CID 124534033
3,5-dibromo-N-[(Z)-(4-bromo-5-morpholin-4-ylfuran-2-yl)methylideneamino]-2-hydroxybenzamide (PubChem CID 124534033) has the molecular formula C16H14Br3N3O4 and a molecular weight of 552.02 g/mol. Its IUPAC name is 3,5-dibromo-N-[(Z)-(4-bromo-5-morpholin-4-ylfuran-2-yl)methylideneamino]-2-hydroxybenzamide.
| Compound Name | 3,5-dibromo-N-[(Z)-(4-bromo-5-morpholin-4-ylfuran-2-yl)methylideneamino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 124534033 |
| Molecular Formula | C16H14Br3N3O4 |
| Molecular Weight | 552.02 g/mol |
| Exact Mass | 548.85 |
| IUPAC Name | 3,5-dibromo-N-[(Z)-(4-bromo-5-morpholin-4-ylfuran-2-yl)methylideneamino]-2-hydroxybenzamide |
| SMILES | O=C(N/N=C\c1cc(Br)c(N2CCOCC2)o1)c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C16H14Br3N3O4/c17-9-5-11(14(23)12(18)6-9)15(24)21-20-8-10-7-13(19)16(26-10)22-1-3-25-4-2-22/h5-8,23H,1-4H2,(H,21,24)/b20-8- |
| InChIKey | XYBITOMVSLFNKL-ZBKNUEDVSA-N |
| XLogP | 3.87 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.02 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|