C19H17ClN2O3S — CID 135824559
5-[(E)-2-(3-chloro-4,5-dihydroxyphenyl)ethenyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-3-one (PubChem CID 135824559) has the molecular formula C19H17ClN2O3S and a molecular weight of 388.88 g/mol. Its IUPAC name is 5-[(E)-2-(3-chloro-4,5-dihydroxyphenyl)ethenyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-3-one.
| Compound Name | 5-[(E)-2-(3-chloro-4,5-dihydroxyphenyl)ethenyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 135824559 |
| Molecular Formula | C19H17ClN2O3S |
| Molecular Weight | 388.88 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 5-[(E)-2-(3-chloro-4,5-dihydroxyphenyl)ethenyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-3-one |
| SMILES | O=c1[nH]c(/C=C/c2cc(O)c(O)c(Cl)c2)nc2sc3c(c12)CCCCC3 |
| InChI | InChI=1S/C19H17ClN2O3S/c20-12-8-10(9-13(23)17(12)24)6-7-15-21-18(25)16-11-4-2-1-3-5-14(11)26-19(16)22-15/h6-9,23-24H,1-5H2,(H,21,22,25)/b7-6+ |
| InChIKey | KYWHDSMPGLHKGF-VOTSOKGWSA-N |
| XLogP | 4.49 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.88 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|