C19H13F5N2OS — CID 16555282
5-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-3-one (PubChem CID 16555282) has the molecular formula C19H13F5N2OS and a molecular weight of 412.38 g/mol. Its IUPAC name is 5-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-3-one.
| Compound Name | 5-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 16555282 |
| Molecular Formula | C19H13F5N2OS |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 5-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-3-one |
| SMILES | O=c1[nH]c(/C=C/c2c(F)c(F)c(F)c(F)c2F)nc2sc3c(c12)CCCCC3 |
| InChI | InChI=1S/C19H13F5N2OS/c20-13-9(14(21)16(23)17(24)15(13)22)6-7-11-25-18(27)12-8-4-2-1-3-5-10(8)28-19(12)26-11/h6-7H,1-5H2,(H,25,26,27)/b7-6+ |
| InChIKey | BXRVNOQHNHGJSQ-VOTSOKGWSA-N |
| XLogP | 5.12 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|