C20H20N2O3S — CID 8015022
2-[(E)-2-(2,3-dimethoxyphenyl)ethenyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 8015022) has the molecular formula C20H20N2O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is 2-[(E)-2-(2,3-dimethoxyphenyl)ethenyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[(E)-2-(2,3-dimethoxyphenyl)ethenyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 8015022 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 2-[(E)-2-(2,3-dimethoxyphenyl)ethenyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | COc1cccc(/C=C/c2nc3sc4c(c3c(=O)[nH]2)CCCC4)c1OC |
| InChI | InChI=1S/C20H20N2O3S/c1-24-14-8-5-6-12(18(14)25-2)10-11-16-21-19(23)17-13-7-3-4-9-15(13)26-20(17)22-16/h5-6,8,10-11H,3-4,7,9H2,1-2H3,(H,21,22,23)/b11-10+ |
| InChIKey | IRCFFABDEMTCIO-ZHACJKMWSA-N |
| XLogP | 4.05 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |