C19H23N3O3S — CID 135824704
N-[2-[4-[2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]acetyl]phenyl]ethyl]acetamide (PubChem CID 135824704) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is N-[2-[4-[2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]acetyl]phenyl]ethyl]acetamide.
| Compound Name | N-[2-[4-[2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]acetyl]phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 135824704 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | N-[2-[4-[2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]acetyl]phenyl]ethyl]acetamide |
| SMILES | CCCc1cc(=O)[nH]c(SCC(=O)c2ccc(CCNC(C)=O)cc2)n1 |
| InChI | InChI=1S/C19H23N3O3S/c1-3-4-16-11-18(25)22-19(21-16)26-12-17(24)15-7-5-14(6-8-15)9-10-20-13(2)23/h5-8,11H,3-4,9-10,12H2,1-2H3,(H,20,23)(H,21,22,25) |
| InChIKey | XXSJJBGIOCMXAO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |