C12H9NO5 — CID 135827979
(3-hydroxy-4-pyridinyl)-(2,3,4-trihydroxyphenyl)methanone (PubChem CID 135827979) has the molecular formula C12H9NO5 and a molecular weight of 247.21 g/mol. Its IUPAC name is (3-hydroxy-4-pyridinyl)-(2,3,4-trihydroxyphenyl)methanone.
| Compound Name | (3-hydroxy-4-pyridinyl)-(2,3,4-trihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 135827979 |
| Molecular Formula | C12H9NO5 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | (3-hydroxy-4-pyridinyl)-(2,3,4-trihydroxyphenyl)methanone |
| SMILES | O=C(c1ccncc1O)c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C12H9NO5/c14-8-2-1-7(11(17)12(8)18)10(16)6-3-4-13-5-9(6)15/h1-5,14-15,17-18H |
| InChIKey | XSGBYZFNVAWJBG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|