C21H27N3O4 — CID 135828702
5-(hydroxymethyl)-4-[[(2S)-2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]iminomethyl]-2-methylpyridin-3-ol (PubChem CID 135828702) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is 5-(hydroxymethyl)-4-[[(2S)-2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]iminomethyl]-2-methylpyridin-3-ol.
| Compound Name | 5-(hydroxymethyl)-4-[[(2S)-2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]iminomethyl]-2-methylpyridin-3-ol |
|---|---|
| PubChem CID | 135828702 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 5-(hydroxymethyl)-4-[[(2S)-2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]iminomethyl]-2-methylpyridin-3-ol |
| SMILES | COc1ccc([C@@H](C/N=C/c2c(CO)cnc(C)c2O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H27N3O4/c1-15-21(26)19(17(14-25)11-23-15)12-22-13-20(24-7-9-28-10-8-24)16-3-5-18(27-2)6-4-16/h3-6,11-12,20,25-26H,7-10,13-14H2,1-2H3/b22-12+/t20-/m1/s1 |
| InChIKey | ZPLMOLVQUVWKMN-XLKWYTADSA-N |
| XLogP | 2.09 |
| TPSA | 87.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|