C16H19N3O4S — CID 135828759
4-[(1R)-1-[[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylideneamino]ethyl]benzenesulfonamide (PubChem CID 135828759) has the molecular formula C16H19N3O4S and a molecular weight of 349.41 g/mol. Its IUPAC name is 4-[(1R)-1-[[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylideneamino]ethyl]benzenesulfonamide.
| Compound Name | 4-[(1R)-1-[[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylideneamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 135828759 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 4-[(1R)-1-[[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylideneamino]ethyl]benzenesulfonamide |
| SMILES | Cc1ncc(CO)c(/C=N/[C@H](C)c2ccc(S(N)(=O)=O)cc2)c1O |
| InChI | InChI=1S/C16H19N3O4S/c1-10(12-3-5-14(6-4-12)24(17,22)23)19-8-15-13(9-20)7-18-11(2)16(15)21/h3-8,10,20-21H,9H2,1-2H3,(H2,17,22,23)/b19-8+/t10-/m1/s1 |
| InChIKey | VBEACRCOVWIBMJ-OQOREVAYSA-N |
| XLogP | 1.42 |
| TPSA | 125.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|