C20H20N2O2 — CID 135828935
5-(hydroxymethyl)-2-methyl-4-[[(1R)-1-naphthalen-1-ylethyl]iminomethyl]pyridin-3-ol (PubChem CID 135828935) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2-methyl-4-[[(1R)-1-naphthalen-1-ylethyl]iminomethyl]pyridin-3-ol.
| Compound Name | 5-(hydroxymethyl)-2-methyl-4-[[(1R)-1-naphthalen-1-ylethyl]iminomethyl]pyridin-3-ol |
|---|---|
| PubChem CID | 135828935 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 5-(hydroxymethyl)-2-methyl-4-[[(1R)-1-naphthalen-1-ylethyl]iminomethyl]pyridin-3-ol |
| SMILES | Cc1ncc(CO)c(/C=N/[C@H](C)c2cccc3ccccc23)c1O |
| InChI | InChI=1S/C20H20N2O2/c1-13(17-9-5-7-15-6-3-4-8-18(15)17)22-11-19-16(12-23)10-21-14(2)20(19)24/h3-11,13,23-24H,12H2,1-2H3/b22-11+/t13-/m1/s1 |
| InChIKey | FISLHYCMSNPMLJ-XIJPWPHISA-N |
| XLogP | 3.92 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|