C21H23N5O4 — CID 135829797
N-[(Z)-1H-indol-3-ylmethylideneamino]-4-[1-(4-nitrophenyl)ethenylamino]butanamide;hydrate (PubChem CID 135829797) has the molecular formula C21H23N5O4 and a molecular weight of 409.45 g/mol. Its IUPAC name is N-[(Z)-1H-indol-3-ylmethylideneamino]-4-[1-(4-nitrophenyl)ethenylamino]butanamide;hydrate.
| Compound Name | N-[(Z)-1H-indol-3-ylmethylideneamino]-4-[1-(4-nitrophenyl)ethenylamino]butanamide;hydrate |
|---|---|
| PubChem CID | 135829797 |
| Molecular Formula | C21H23N5O4 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | N-[(Z)-1H-indol-3-ylmethylideneamino]-4-[1-(4-nitrophenyl)ethenylamino]butanamide;hydrate |
| SMILES | C=C(NCCCC(=O)N/N=C\c1c[nH]c2ccccc12)c1ccc([N+](=O)[O-])cc1.O |
| InChI | InChI=1S/C21H21N5O3.H2O/c1-15(16-8-10-18(11-9-16)26(28)29)22-12-4-7-21(27)25-24-14-17-13-23-20-6-3-2-5-19(17)20;/h2-3,5-6,8-11,13-14,22-23H,1,4,7,12H2,(H,25,27);1H2/b24-14-; |
| InChIKey | TXEWWLDWDHRAGB-LTMIIBIKSA-N |
| XLogP | 2.74 |
| TPSA | 143.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|