C20H24F4N5O2+ — CID 135832776
(5R,7S)-5-(4-fluorophenyl)-N-(2-morpholin-4-ium-4-ylethyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 135832776) has the molecular formula C20H24F4N5O2+ and a molecular weight of 442.44 g/mol. Its IUPAC name is (5R,7S)-5-(4-fluorophenyl)-N-(2-morpholin-4-ium-4-ylethyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5R,7S)-5-(4-fluorophenyl)-N-(2-morpholin-4-ium-4-ylethyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 135832776 |
| Molecular Formula | C20H24F4N5O2+ |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | (5R,7S)-5-(4-fluorophenyl)-N-(2-morpholin-4-ium-4-ylethyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | O=C(NCC[NH+]1CCOCC1)c1cc2n(n1)[C@H](C(F)(F)F)C[C@H](c1ccc(F)cc1)N2 |
| InChI | InChI=1S/C20H23F4N5O2/c21-14-3-1-13(2-4-14)15-11-17(20(22,23)24)29-18(26-15)12-16(27-29)19(30)25-5-6-28-7-9-31-10-8-28/h1-4,12,15,17,26H,5-11H2,(H,25,30)/p+1/t15-,17+/m1/s1 |
| InChIKey | VBGUXTVILJAYNN-WBVHZDCISA-O |
| XLogP | 1.33 |
| TPSA | 72.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |