C19H20N2O4S2 — CID 135832827
ethyl (6R,7E)-2-acetamido-7-hydroxyimino-6-phenylsulfanyl-5,6-dihydro-4H-1-benzothiophene-3-carboxylate (PubChem CID 135832827) has the molecular formula C19H20N2O4S2 and a molecular weight of 404.51 g/mol. Its IUPAC name is ethyl (6R,7E)-2-acetamido-7-hydroxyimino-6-phenylsulfanyl-5,6-dihydro-4H-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl (6R,7E)-2-acetamido-7-hydroxyimino-6-phenylsulfanyl-5,6-dihydro-4H-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 135832827 |
| Molecular Formula | C19H20N2O4S2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | ethyl (6R,7E)-2-acetamido-7-hydroxyimino-6-phenylsulfanyl-5,6-dihydro-4H-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(C)=O)sc2c1CC[C@@H](Sc1ccccc1)/C2=N\O |
| InChI | InChI=1S/C19H20N2O4S2/c1-3-25-19(23)15-13-9-10-14(26-12-7-5-4-6-8-12)16(21-24)17(13)27-18(15)20-11(2)22/h4-8,14,24H,3,9-10H2,1-2H3,(H,20,22)/b21-16+/t14-/m1/s1 |
| InChIKey | IOEXOESFPUIGLA-HDOZFUISSA-N |
| XLogP | 4.17 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|