C20H19IN2O5S — CID 135529666
ethyl (7E)-2-acetamido-7-(3-iodobenzoyl)oxyimino-5,6-dihydro-4H-1-benzothiophene-3-carboxylate (PubChem CID 135529666) has the molecular formula C20H19IN2O5S and a molecular weight of 526.35 g/mol. Its IUPAC name is ethyl (7E)-2-acetamido-7-(3-iodobenzoyl)oxyimino-5,6-dihydro-4H-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl (7E)-2-acetamido-7-(3-iodobenzoyl)oxyimino-5,6-dihydro-4H-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 135529666 |
| Molecular Formula | C20H19IN2O5S |
| Molecular Weight | 526.35 g/mol |
| Exact Mass | 526.01 |
| IUPAC Name | ethyl (7E)-2-acetamido-7-(3-iodobenzoyl)oxyimino-5,6-dihydro-4H-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(C)=O)sc2c1CCC/C2=N\OC(=O)c1cccc(I)c1 |
| InChI | InChI=1S/C20H19IN2O5S/c1-3-27-20(26)16-14-8-5-9-15(17(14)29-18(16)22-11(2)24)23-28-19(25)12-6-4-7-13(21)10-12/h4,6-7,10H,3,5,8-9H2,1-2H3,(H,22,24)/b23-15+ |
| InChIKey | GTRPLMIGGRRYER-HZHRSRAPSA-N |
| XLogP | 4.39 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.35 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|