C18H20ClN5O4S — CID 135679407
ethyl (7E)-2-acetamido-7-[(4-chloro-1-methylpyrazole-5-carbonyl)hydrazinylidene]-5,6-dihydro-4H-1-benzothiophene-3-carboxylate (PubChem CID 135679407) has the molecular formula C18H20ClN5O4S and a molecular weight of 437.91 g/mol. Its IUPAC name is ethyl (7E)-2-acetamido-7-[(4-chloro-1-methylpyrazole-5-carbonyl)hydrazinylidene]-5,6-dihydro-4H-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl (7E)-2-acetamido-7-[(4-chloro-1-methylpyrazole-5-carbonyl)hydrazinylidene]-5,6-dihydro-4H-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 135679407 |
| Molecular Formula | C18H20ClN5O4S |
| Molecular Weight | 437.91 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | ethyl (7E)-2-acetamido-7-[(4-chloro-1-methylpyrazole-5-carbonyl)hydrazinylidene]-5,6-dihydro-4H-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(C)=O)sc2c1CCC/C2=N\NC(=O)c1c(Cl)cnn1C |
| InChI | InChI=1S/C18H20ClN5O4S/c1-4-28-18(27)13-10-6-5-7-12(15(10)29-17(13)21-9(2)25)22-23-16(26)14-11(19)8-20-24(14)3/h8H,4-7H2,1-3H3,(H,21,25)(H,23,26)/b22-12+ |
| InChIKey | JSEKSADAFIDLCQ-WSDLNYQXSA-N |
| XLogP | 2.74 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.91 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|