C27H29N5O5 — CID 135833436
ethyl 5-[3-[[benzyl(methyl)amino]methyl]-1,2,4-oxadiazol-5-yl]-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate (PubChem CID 135833436) has the molecular formula C27H29N5O5 and a molecular weight of 503.56 g/mol. Its IUPAC name is ethyl 5-[3-[[benzyl(methyl)amino]methyl]-1,2,4-oxadiazol-5-yl]-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate.
| Compound Name | ethyl 5-[3-[[benzyl(methyl)amino]methyl]-1,2,4-oxadiazol-5-yl]-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 135833436 |
| Molecular Formula | C27H29N5O5 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | ethyl 5-[3-[[benzyl(methyl)amino]methyl]-1,2,4-oxadiazol-5-yl]-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(c2nc(CN(C)Cc3ccccc3)no2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H29N5O5/c1-5-36-27(33)24-18(3)28-17(2)23(25(24)20-12-9-13-21(14-20)32(34)35)26-29-22(30-37-26)16-31(4)15-19-10-7-6-8-11-19/h6-14,25,28H,5,15-16H2,1-4H3 |
| InChIKey | JBYYARXKXGNUFF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|