C18H13FN2O3S — CID 135834802
methyl 2-[[(5Z)-5-[(2-fluorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 135834802) has the molecular formula C18H13FN2O3S and a molecular weight of 356.38 g/mol. Its IUPAC name is methyl 2-[[(5Z)-5-[(2-fluorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | methyl 2-[[(5Z)-5-[(2-fluorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 135834802 |
| Molecular Formula | C18H13FN2O3S |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | methyl 2-[[(5Z)-5-[(2-fluorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | COC(=O)c1ccccc1/N=C1\NC(=O)/C(=C/c2ccccc2F)S1 |
| InChI | InChI=1S/C18H13FN2O3S/c1-24-17(23)12-7-3-5-9-14(12)20-18-21-16(22)15(25-18)10-11-6-2-4-8-13(11)19/h2-10H,1H3,(H,20,21,22)/b15-10- |
| InChIKey | FLIPDKOTDFQIGP-GDNBJRDFSA-N |
| XLogP | 3.50 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|