C21H18N2O4S — CID 135834766
methyl 2-[[(5Z)-4-oxo-5-[(2-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 135834766) has the molecular formula C21H18N2O4S and a molecular weight of 394.45 g/mol. Its IUPAC name is methyl 2-[[(5Z)-4-oxo-5-[(2-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | methyl 2-[[(5Z)-4-oxo-5-[(2-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 135834766 |
| Molecular Formula | C21H18N2O4S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | methyl 2-[[(5Z)-4-oxo-5-[(2-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | C=CCOc1ccccc1/C=C1\S/C(=N/c2ccccc2C(=O)OC)NC1=O |
| InChI | InChI=1S/C21H18N2O4S/c1-3-12-27-17-11-7-4-8-14(17)13-18-19(24)23-21(28-18)22-16-10-6-5-9-15(16)20(25)26-2/h3-11,13H,1,12H2,2H3,(H,22,23,24)/b18-13- |
| InChIKey | ABDFHBWFQRINAQ-AQTBWJFISA-N |
| XLogP | 3.93 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|