C16H10N8O2 — CID 135836237
4-[3-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-yl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 135836237) has the molecular formula C16H10N8O2 and a molecular weight of 346.31 g/mol. Its IUPAC name is 4-[3-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-yl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-[3-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-yl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 135836237 |
| Molecular Formula | C16H10N8O2 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 4-[3-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-yl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | c1cc2c(cc1-c1cc(-c3nc4c5cn[nH]c5ncn4n3)[nH]n1)OCO2 |
| InChI | InChI=1S/C16H10N8O2/c1-2-12-13(26-7-25-12)3-8(1)10-4-11(21-20-10)15-19-16-9-5-18-22-14(9)17-6-24(16)23-15/h1-6H,7H2,(H,18,22)(H,20,21) |
| InChIKey | KHJYMZQLSKGABV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 118.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |