C22H14N8O2 — CID 19571449
4-[3-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-yl]-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 19571449) has the molecular formula C22H14N8O2 and a molecular weight of 422.41 g/mol. Its IUPAC name is 4-[3-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-yl]-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-[3-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-yl]-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 19571449 |
| Molecular Formula | C22H14N8O2 |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 4-[3-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-yl]-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | c1ccc(-n2ncc3c2ncn2nc(-c4cc(-c5ccc6c(c5)OCO6)n[nH]4)nc32)cc1 |
| InChI | InChI=1S/C22H14N8O2/c1-2-4-14(5-3-1)30-21-15(10-24-30)22-25-20(28-29(22)11-23-21)17-9-16(26-27-17)13-6-7-18-19(8-13)32-12-31-18/h1-11H,12H2,(H,26,27) |
| InChIKey | HISAUYKQOWMQCO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 108.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |