C12H10IN3O — CID 135838199
3-amino-9-iodo-5,6-dihydro-2H-benzo[f]quinazolin-1-one (PubChem CID 135838199) has the molecular formula C12H10IN3O and a molecular weight of 339.14 g/mol. Its IUPAC name is 3-amino-9-iodo-5,6-dihydro-2H-benzo[f]quinazolin-1-one.
| Compound Name | 3-amino-9-iodo-5,6-dihydro-2H-benzo[f]quinazolin-1-one |
|---|---|
| PubChem CID | 135838199 |
| Molecular Formula | C12H10IN3O |
| Molecular Weight | 339.14 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | 3-amino-9-iodo-5,6-dihydro-2H-benzo[f]quinazolin-1-one |
| SMILES | Nc1nc2c(c(=O)[nH]1)-c1cc(I)ccc1CC2 |
| InChI | InChI=1S/C12H10IN3O/c13-7-3-1-6-2-4-9-10(8(6)5-7)11(17)16-12(14)15-9/h1,3,5H,2,4H2,(H3,14,15,16,17) |
| InChIKey | HLVZKTWDLVFUCG-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.14 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|