C20H19BrN2O3 — CID 135838591
propan-2-yl 4-[(5-bromo-7-ethyl-2-oxo-1H-indol-3-ylidene)amino]benzoate (PubChem CID 135838591) has the molecular formula C20H19BrN2O3 and a molecular weight of 415.29 g/mol. Its IUPAC name is propan-2-yl 4-[(5-bromo-7-ethyl-2-oxo-1H-indol-3-ylidene)amino]benzoate.
| Compound Name | propan-2-yl 4-[(5-bromo-7-ethyl-2-oxo-1H-indol-3-ylidene)amino]benzoate |
|---|---|
| PubChem CID | 135838591 |
| Molecular Formula | C20H19BrN2O3 |
| Molecular Weight | 415.29 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | propan-2-yl 4-[(5-bromo-7-ethyl-2-oxo-1H-indol-3-ylidene)amino]benzoate |
| SMILES | CCc1cc(Br)cc2c1NC(=O)/C2=N\c1ccc(C(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C20H19BrN2O3/c1-4-12-9-14(21)10-16-17(12)23-19(24)18(16)22-15-7-5-13(6-8-15)20(25)26-11(2)3/h5-11H,4H2,1-3H3,(H,22,23,24) |
| InChIKey | WXVXZQVTXTUZOS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.29 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|