C15H9Br2ClN2O — CID 135559779
5-bromo-3-(4-bromophenyl)imino-6-chloro-7-methyl-1H-indol-2-one (PubChem CID 135559779) has the molecular formula C15H9Br2ClN2O and a molecular weight of 428.51 g/mol. Its IUPAC name is 5-bromo-3-(4-bromophenyl)imino-6-chloro-7-methyl-1H-indol-2-one.
| Compound Name | 5-bromo-3-(4-bromophenyl)imino-6-chloro-7-methyl-1H-indol-2-one |
|---|---|
| PubChem CID | 135559779 |
| Molecular Formula | C15H9Br2ClN2O |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 425.88 |
| IUPAC Name | 5-bromo-3-(4-bromophenyl)imino-6-chloro-7-methyl-1H-indol-2-one |
| SMILES | Cc1c(Cl)c(Br)cc2c1NC(=O)/C2=N\c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H9Br2ClN2O/c1-7-12(18)11(17)6-10-13(7)20-15(21)14(10)19-9-4-2-8(16)3-5-9/h2-6H,1H3,(H,19,20,21) |
| InChIKey | GRGWIDPJQMRTOU-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|