C17H14BrClN2O3 — CID 135559793
5-bromo-6-chloro-3-(2,5-dimethoxyphenyl)imino-7-methyl-1H-indol-2-one (PubChem CID 135559793) has the molecular formula C17H14BrClN2O3 and a molecular weight of 409.67 g/mol. Its IUPAC name is 5-bromo-6-chloro-3-(2,5-dimethoxyphenyl)imino-7-methyl-1H-indol-2-one.
| Compound Name | 5-bromo-6-chloro-3-(2,5-dimethoxyphenyl)imino-7-methyl-1H-indol-2-one |
|---|---|
| PubChem CID | 135559793 |
| Molecular Formula | C17H14BrClN2O3 |
| Molecular Weight | 409.67 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | 5-bromo-6-chloro-3-(2,5-dimethoxyphenyl)imino-7-methyl-1H-indol-2-one |
| SMILES | COc1ccc(OC)c(/N=C2\C(=O)Nc3c2cc(Br)c(Cl)c3C)c1 |
| InChI | InChI=1S/C17H14BrClN2O3/c1-8-14(19)11(18)7-10-15(8)21-17(22)16(10)20-12-6-9(23-2)4-5-13(12)24-3/h4-7H,1-3H3,(H,20,21,22) |
| InChIKey | XYQBEQXFCOBUCV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.67 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|