C17H15ClN2O3 — CID 135559647
6-chloro-3-(2,4-dimethoxyphenyl)imino-7-methyl-1H-indol-2-one (PubChem CID 135559647) has the molecular formula C17H15ClN2O3 and a molecular weight of 330.77 g/mol. Its IUPAC name is 6-chloro-3-(2,4-dimethoxyphenyl)imino-7-methyl-1H-indol-2-one.
| Compound Name | 6-chloro-3-(2,4-dimethoxyphenyl)imino-7-methyl-1H-indol-2-one |
|---|---|
| PubChem CID | 135559647 |
| Molecular Formula | C17H15ClN2O3 |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 6-chloro-3-(2,4-dimethoxyphenyl)imino-7-methyl-1H-indol-2-one |
| SMILES | COc1ccc(/N=C2\C(=O)Nc3c2ccc(Cl)c3C)c(OC)c1 |
| InChI | InChI=1S/C17H15ClN2O3/c1-9-12(18)6-5-11-15(9)20-17(21)16(11)19-13-7-4-10(22-2)8-14(13)23-3/h4-8H,1-3H3,(H,19,20,21) |
| InChIKey | LOLPCEVIFUBPQM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|