C17H15BrN2O — CID 135501542
5-bromo-7-ethyl-3-(4-methylphenyl)imino-1H-indol-2-one (PubChem CID 135501542) has the molecular formula C17H15BrN2O and a molecular weight of 343.22 g/mol. Its IUPAC name is 5-bromo-7-ethyl-3-(4-methylphenyl)imino-1H-indol-2-one.
| Compound Name | 5-bromo-7-ethyl-3-(4-methylphenyl)imino-1H-indol-2-one |
|---|---|
| PubChem CID | 135501542 |
| Molecular Formula | C17H15BrN2O |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 5-bromo-7-ethyl-3-(4-methylphenyl)imino-1H-indol-2-one |
| SMILES | CCc1cc(Br)cc2c1NC(=O)/C2=N\c1ccc(C)cc1 |
| InChI | InChI=1S/C17H15BrN2O/c1-3-11-8-12(18)9-14-15(11)20-17(21)16(14)19-13-6-4-10(2)5-7-13/h4-9H,3H2,1-2H3,(H,19,20,21) |
| InChIKey | CCZRXEBZAHPODO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|