C27H26N6O2 — CID 135838907
2-(3,4-dimethylphenyl)-7-(3-methoxyphenyl)-5-methyl-N-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135838907) has the molecular formula C27H26N6O2 and a molecular weight of 466.55 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-7-(3-methoxyphenyl)-5-methyl-N-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-(3,4-dimethylphenyl)-7-(3-methoxyphenyl)-5-methyl-N-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135838907 |
| Molecular Formula | C27H26N6O2 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-7-(3-methoxyphenyl)-5-methyl-N-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1cccc(C2C(C(=O)Nc3cccnc3)=C(C)Nc3nc(-c4ccc(C)c(C)c4)nn32)c1 |
| InChI | InChI=1S/C27H26N6O2/c1-16-10-11-20(13-17(16)2)25-31-27-29-18(3)23(26(34)30-21-8-6-12-28-15-21)24(33(27)32-25)19-7-5-9-22(14-19)35-4/h5-15,24H,1-4H3,(H,30,34)(H,29,31,32) |
| InChIKey | LUTOGOUHDTUGKA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |