C28H28N6O5 — CID 135813601
2-(3-methoxyphenyl)-5-methyl-N-pyridin-3-yl-7-(2,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135813601) has the molecular formula C28H28N6O5 and a molecular weight of 528.57 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-5-methyl-N-pyridin-3-yl-7-(2,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-(3-methoxyphenyl)-5-methyl-N-pyridin-3-yl-7-(2,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135813601 |
| Molecular Formula | C28H28N6O5 |
| Molecular Weight | 528.57 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | 2-(3-methoxyphenyl)-5-methyl-N-pyridin-3-yl-7-(2,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1cccc(-c2nc3n(n2)C(c2cc(OC)c(OC)cc2OC)C(C(=O)Nc2cccnc2)=C(C)N3)c1 |
| InChI | InChI=1S/C28H28N6O5/c1-16-24(27(35)31-18-9-7-11-29-15-18)25(20-13-22(38-4)23(39-5)14-21(20)37-3)34-28(30-16)32-26(33-34)17-8-6-10-19(12-17)36-2/h6-15,25H,1-5H3,(H,31,35)(H,30,32,33) |
| InChIKey | MCIJLWHDMSPFNF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.57 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |