C27H26N6O4 — CID 136755073
(7R)-7-(2,3-dimethoxyphenyl)-2-(4-methoxyphenyl)-5-methyl-N-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 136755073) has the molecular formula C27H26N6O4 and a molecular weight of 498.54 g/mol. Its IUPAC name is (7R)-7-(2,3-dimethoxyphenyl)-2-(4-methoxyphenyl)-5-methyl-N-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7R)-7-(2,3-dimethoxyphenyl)-2-(4-methoxyphenyl)-5-methyl-N-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 136755073 |
| Molecular Formula | C27H26N6O4 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | (7R)-7-(2,3-dimethoxyphenyl)-2-(4-methoxyphenyl)-5-methyl-N-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccc(-c2nc3n(n2)[C@H](c2cccc(OC)c2OC)C(C(=O)Nc2cccnc2)=C(C)N3)cc1 |
| InChI | InChI=1S/C27H26N6O4/c1-16-22(26(34)30-18-7-6-14-28-15-18)23(20-8-5-9-21(36-3)24(20)37-4)33-27(29-16)31-25(32-33)17-10-12-19(35-2)13-11-17/h5-15,23H,1-4H3,(H,30,34)(H,29,31,32)/t23-/m1/s1 |
| InChIKey | RJCGSQQSTYEZMB-HSZRJFAPSA-N |
| XLogP | 4.29 |
| TPSA | 112.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |