C25H21N7O4 — CID 135610412
7-(2-methoxyphenyl)-5-methyl-2-(4-nitrophenyl)-N-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135610412) has the molecular formula C25H21N7O4 and a molecular weight of 483.49 g/mol. Its IUPAC name is 7-(2-methoxyphenyl)-5-methyl-2-(4-nitrophenyl)-N-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(2-methoxyphenyl)-5-methyl-2-(4-nitrophenyl)-N-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135610412 |
| Molecular Formula | C25H21N7O4 |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 7-(2-methoxyphenyl)-5-methyl-2-(4-nitrophenyl)-N-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccccc1C1C(C(=O)Nc2cccnc2)=C(C)Nc2nc(-c3ccc([N+](=O)[O-])cc3)nn21 |
| InChI | InChI=1S/C25H21N7O4/c1-15-21(24(33)28-17-6-5-13-26-14-17)22(19-7-3-4-8-20(19)36-2)31-25(27-15)29-23(30-31)16-9-11-18(12-10-16)32(34)35/h3-14,22H,1-2H3,(H,28,33)(H,27,29,30) |
| InChIKey | XCEXGGJHNGXYDE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|