C28H26N6O5 — CID 135709926
7-(2-ethoxyphenyl)-N-(2-methoxyphenyl)-5-methyl-2-(4-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135709926) has the molecular formula C28H26N6O5 and a molecular weight of 526.55 g/mol. Its IUPAC name is 7-(2-ethoxyphenyl)-N-(2-methoxyphenyl)-5-methyl-2-(4-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(2-ethoxyphenyl)-N-(2-methoxyphenyl)-5-methyl-2-(4-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135709926 |
| Molecular Formula | C28H26N6O5 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | 7-(2-ethoxyphenyl)-N-(2-methoxyphenyl)-5-methyl-2-(4-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCOc1ccccc1C1C(C(=O)Nc2ccccc2OC)=C(C)Nc2nc(-c3ccc([N+](=O)[O-])cc3)nn21 |
| InChI | InChI=1S/C28H26N6O5/c1-4-39-22-11-7-5-9-20(22)25-24(27(35)30-21-10-6-8-12-23(21)38-3)17(2)29-28-31-26(32-33(25)28)18-13-15-19(16-14-18)34(36)37/h5-16,25H,4H2,1-3H3,(H,30,35)(H,29,31,32) |
| InChIKey | XIURZVNOYRHSBC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 133.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|