C27H24Cl2N6O4 — CID 135798795
2-(2,4-dichlorophenyl)-5-methyl-N-pyridin-3-yl-7-(2,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135798795) has the molecular formula C27H24Cl2N6O4 and a molecular weight of 567.43 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-5-methyl-N-pyridin-3-yl-7-(2,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-(2,4-dichlorophenyl)-5-methyl-N-pyridin-3-yl-7-(2,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135798795 |
| Molecular Formula | C27H24Cl2N6O4 |
| Molecular Weight | 567.43 g/mol |
| Exact Mass | 566.12 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-5-methyl-N-pyridin-3-yl-7-(2,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1cc(OC)c(C2C(C(=O)Nc3cccnc3)=C(C)Nc3nc(-c4ccc(Cl)cc4Cl)nn32)cc1OC |
| InChI | InChI=1S/C27H24Cl2N6O4/c1-14-23(26(36)32-16-6-5-9-30-13-16)24(18-11-21(38-3)22(39-4)12-20(18)37-2)35-27(31-14)33-25(34-35)17-8-7-15(28)10-19(17)29/h5-13,24H,1-4H3,(H,32,36)(H,31,33,34) |
| InChIKey | MXTHXXKYOHSHRL-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 112.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.43 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |