C27H25ClN6O4 — CID 135796025
2-(2-chlorophenyl)-5-methyl-N-pyridin-3-yl-7-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135796025) has the molecular formula C27H25ClN6O4 and a molecular weight of 532.99 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-5-methyl-N-pyridin-3-yl-7-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-(2-chlorophenyl)-5-methyl-N-pyridin-3-yl-7-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135796025 |
| Molecular Formula | C27H25ClN6O4 |
| Molecular Weight | 532.99 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | 2-(2-chlorophenyl)-5-methyl-N-pyridin-3-yl-7-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1cc(C2C(C(=O)Nc3cccnc3)=C(C)Nc3nc(-c4ccccc4Cl)nn32)cc(OC)c1OC |
| InChI | InChI=1S/C27H25ClN6O4/c1-15-22(26(35)31-17-8-7-11-29-14-17)23(16-12-20(36-2)24(38-4)21(13-16)37-3)34-27(30-15)32-25(33-34)18-9-5-6-10-19(18)28/h5-14,23H,1-4H3,(H,31,35)(H,30,32,33) |
| InChIKey | GVHGOYGAKDCCIR-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 112.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.99 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |