C28H27FN6O4S — CID 136719780
(7S)-2-[(2-fluorophenyl)methylsulfanyl]-5-methyl-N-pyridin-3-yl-7-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 136719780) has the molecular formula C28H27FN6O4S and a molecular weight of 562.63 g/mol. Its IUPAC name is (7S)-2-[(2-fluorophenyl)methylsulfanyl]-5-methyl-N-pyridin-3-yl-7-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7S)-2-[(2-fluorophenyl)methylsulfanyl]-5-methyl-N-pyridin-3-yl-7-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 136719780 |
| Molecular Formula | C28H27FN6O4S |
| Molecular Weight | 562.63 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | (7S)-2-[(2-fluorophenyl)methylsulfanyl]-5-methyl-N-pyridin-3-yl-7-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1cc([C@H]2C(C(=O)Nc3cccnc3)=C(C)Nc3nc(SCc4ccccc4F)nn32)cc(OC)c1OC |
| InChI | InChI=1S/C28H27FN6O4S/c1-16-23(26(36)32-19-9-7-11-30-14-19)24(18-12-21(37-2)25(39-4)22(13-18)38-3)35-27(31-16)33-28(34-35)40-15-17-8-5-6-10-20(17)29/h5-14,24H,15H2,1-4H3,(H,32,36)(H,31,33,34)/t24-/m0/s1 |
| InChIKey | AYYOUGYTAKZAOZ-DEOSSOPVSA-N |
| XLogP | 5.06 |
| TPSA | 112.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.63 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |