C26H24N6O3 — CID 135778570
7-(2,5-dimethoxyphenyl)-5-methyl-N-phenyl-2-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135778570) has the molecular formula C26H24N6O3 and a molecular weight of 468.52 g/mol. Its IUPAC name is 7-(2,5-dimethoxyphenyl)-5-methyl-N-phenyl-2-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(2,5-dimethoxyphenyl)-5-methyl-N-phenyl-2-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135778570 |
| Molecular Formula | C26H24N6O3 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 7-(2,5-dimethoxyphenyl)-5-methyl-N-phenyl-2-pyridin-3-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccc(OC)c(C2C(C(=O)Nc3ccccc3)=C(C)Nc3nc(-c4cccnc4)nn32)c1 |
| InChI | InChI=1S/C26H24N6O3/c1-16-22(25(33)29-18-9-5-4-6-10-18)23(20-14-19(34-2)11-12-21(20)35-3)32-26(28-16)30-24(31-32)17-8-7-13-27-15-17/h4-15,23H,1-3H3,(H,29,33)(H,28,30,31) |
| InChIKey | MFOAKNIGUPQFBW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |