About 4-amino-3-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-1,5-naphthyridin-2-one
4-amino-3-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-1,5-naphthyridin-2-one (PubChem CID 135839371) has the molecular formula C20H21N7O
and a molecular weight of 375.44 g/mol. Its IUPAC name is 4-amino-3-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-1,5-naphthyridin-2-one.
Molecular Properties
| Compound Name | 4-amino-3-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-1,5-naphthyridin-2-one |
| PubChem CID | 135839371 |
| Molecular Formula | C20H21N7O |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 4-amino-3-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-1,5-naphthyridin-2-one |
| SMILES | CN1CCN(c2ccc3nc(-c4c(N)c5ncccc5[nH]c4=O)[nH]c3c2)CC1 |
| InChI | InChI=1S/C20H21N7O/c1-26-7-9-27(10-8-26)12-4-5-13-15(11-12)24-19(23-13)16-17(21)18-14(25-20(16)28)3-2-6-22-18/h2-6,11H,7-10H2,1H3,(H,23,24)(H3,21,25,28) |
| InChIKey | KCJHQDVGQZJZAJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 106.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-amino-3-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-1,5-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-1,5-naphthyridin-2-one?
The IUPAC name of 4-amino-3-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-1,5-naphthyridin-2-one (CID 135839371) is 4-amino-3-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-1,5-naphthyridin-2-one.
What is the SMILES notation for 4-amino-3-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-1,5-naphthyridin-2-one?
The canonical SMILES for 4-amino-3-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-1,5-naphthyridin-2-one is CN1CCN(c2ccc3nc(-c4c(N)c5ncccc5[nH]c4=O)[nH]c3c2)CC1.
What is the InChIKey of 4-amino-3-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-1,5-naphthyridin-2-one?
The InChIKey is KCJHQDVGQZJZAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N7O/c1-26-7-9-27(10-8-26)12-4-5-13-15(11-12)24-19(23-13)16-17(21)18-14(25-20(16)28)3-2-6-22-18/h2-6,11H,7-10H2,1H3,(H,23,24)(H3,21,25,28).
What are the key properties of 4-amino-3-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-1,5-naphthyridin-2-one?
4-amino-3-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-1,5-naphthyridin-2-one has a molecular weight of 375.44 g/mol, XLogP of 1.80, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-1,5-naphthyridin-2-one is sourced from PubChem (CID 135839371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).