C22H24FN6O2+ — CID 142896988
4-amino-5-fluoro-3-[6-(4-methoxy-4-methylpiperazin-4-ium-1-yl)-1H-benzimidazol-2-yl]-1H-quinolin-2-one (PubChem CID 142896988) has the molecular formula C22H24FN6O2+ and a molecular weight of 423.47 g/mol. Its IUPAC name is 4-amino-5-fluoro-3-[6-(4-methoxy-4-methylpiperazin-4-ium-1-yl)-1H-benzimidazol-2-yl]-1H-quinolin-2-one.
| Compound Name | 4-amino-5-fluoro-3-[6-(4-methoxy-4-methylpiperazin-4-ium-1-yl)-1H-benzimidazol-2-yl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 142896988 |
| Molecular Formula | C22H24FN6O2+ |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 4-amino-5-fluoro-3-[6-(4-methoxy-4-methylpiperazin-4-ium-1-yl)-1H-benzimidazol-2-yl]-1H-quinolin-2-one |
| SMILES | CO[N+]1(C)CCN(c2ccc3nc(-c4c(N)c5c(F)cccc5[nH]c4=O)[nH]c3c2)CC1 |
| InChI | InChI=1S/C22H23FN6O2/c1-29(31-2)10-8-28(9-11-29)13-6-7-15-17(12-13)26-21(25-15)19-20(24)18-14(23)4-3-5-16(18)27-22(19)30/h3-7,12H,8-11H2,1-2H3,(H3-,24,25,26,27,30)/p+1 |
| InChIKey | VWEBPICWWROMNO-UHFFFAOYSA-O |
| XLogP | 2.62 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|