C20H18N4O3S2 — CID 135840291
3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]propanamide (PubChem CID 135840291) has the molecular formula C20H18N4O3S2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]propanamide.
| Compound Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 135840291 |
| Molecular Formula | C20H18N4O3S2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]propanamide |
| SMILES | Cc1nc(-c2cccc(NC(=O)CC/N=C3\NS(=O)(=O)c4ccccc43)c2)cs1 |
| InChI | InChI=1S/C20H18N4O3S2/c1-13-22-17(12-28-13)14-5-4-6-15(11-14)23-19(25)9-10-21-20-16-7-2-3-8-18(16)29(26,27)24-20/h2-8,11-12H,9-10H2,1H3,(H,21,24)(H,23,25) |
| InChIKey | UPSNTSMQXNVNIK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|