About ethyl 5-(2,4-difluorobenzoyl)-2-(2-ethoxy-2-oxoethyl)-4-hydroxy-1-methylpyrrole-3-carboxylate
ethyl 5-(2,4-difluorobenzoyl)-2-(2-ethoxy-2-oxoethyl)-4-hydroxy-1-methylpyrrole-3-carboxylate (PubChem CID 135841633) has the molecular formula C19H19F2NO6
and a molecular weight of 395.36 g/mol. Its IUPAC name is ethyl 5-(2,4-difluorobenzoyl)-2-(2-ethoxy-2-oxoethyl)-4-hydroxy-1-methylpyrrole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(2,4-difluorobenzoyl)-2-(2-ethoxy-2-oxoethyl)-4-hydroxy-1-methylpyrrole-3-carboxylate |
| PubChem CID | 135841633 |
| Molecular Formula | C19H19F2NO6 |
| Molecular Weight | 395.36 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | ethyl 5-(2,4-difluorobenzoyl)-2-(2-ethoxy-2-oxoethyl)-4-hydroxy-1-methylpyrrole-3-carboxylate |
| SMILES | CCOC(=O)Cc1c(C(=O)OCC)c(O)c(C(=O)c2ccc(F)cc2F)n1C |
| InChI | InChI=1S/C19H19F2NO6/c1-4-27-14(23)9-13-15(19(26)28-5-2)18(25)16(22(13)3)17(24)11-7-6-10(20)8-12(11)21/h6-8,25H,4-5,9H2,1-3H3 |
| InChIKey | CSSGPWQYMXVKRC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 5-(2,4-difluorobenzoyl)-2-(2-ethoxy-2-oxoethyl)-4-hydroxy-1-methylpyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(2,4-difluorobenzoyl)-2-(2-ethoxy-2-oxoethyl)-4-hydroxy-1-methylpyrrole-3-carboxylate?
The IUPAC name of ethyl 5-(2,4-difluorobenzoyl)-2-(2-ethoxy-2-oxoethyl)-4-hydroxy-1-methylpyrrole-3-carboxylate (CID 135841633) is ethyl 5-(2,4-difluorobenzoyl)-2-(2-ethoxy-2-oxoethyl)-4-hydroxy-1-methylpyrrole-3-carboxylate.
What is the SMILES notation for ethyl 5-(2,4-difluorobenzoyl)-2-(2-ethoxy-2-oxoethyl)-4-hydroxy-1-methylpyrrole-3-carboxylate?
The canonical SMILES for ethyl 5-(2,4-difluorobenzoyl)-2-(2-ethoxy-2-oxoethyl)-4-hydroxy-1-methylpyrrole-3-carboxylate is CCOC(=O)Cc1c(C(=O)OCC)c(O)c(C(=O)c2ccc(F)cc2F)n1C.
What is the InChIKey of ethyl 5-(2,4-difluorobenzoyl)-2-(2-ethoxy-2-oxoethyl)-4-hydroxy-1-methylpyrrole-3-carboxylate?
The InChIKey is CSSGPWQYMXVKRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19F2NO6/c1-4-27-14(23)9-13-15(19(26)28-5-2)18(25)16(22(13)3)17(24)11-7-6-10(20)8-12(11)21/h6-8,25H,4-5,9H2,1-3H3.
What are the key properties of ethyl 5-(2,4-difluorobenzoyl)-2-(2-ethoxy-2-oxoethyl)-4-hydroxy-1-methylpyrrole-3-carboxylate?
ethyl 5-(2,4-difluorobenzoyl)-2-(2-ethoxy-2-oxoethyl)-4-hydroxy-1-methylpyrrole-3-carboxylate has a molecular weight of 395.36 g/mol, XLogP of 2.52, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(2,4-difluorobenzoyl)-2-(2-ethoxy-2-oxoethyl)-4-hydroxy-1-methylpyrrole-3-carboxylate is sourced from PubChem (CID 135841633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).