C19H14Cl2N4OS — CID 135843265
9-(2,4-dichlorophenyl)-2-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135843265) has the molecular formula C19H14Cl2N4OS and a molecular weight of 417.32 g/mol. Its IUPAC name is 9-(2,4-dichlorophenyl)-2-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 9-(2,4-dichlorophenyl)-2-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135843265 |
| Molecular Formula | C19H14Cl2N4OS |
| Molecular Weight | 417.32 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | 9-(2,4-dichlorophenyl)-2-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | O=C1CCCC2=C1C(c1ccc(Cl)cc1Cl)n1nc(-c3cccs3)nc1N2 |
| InChI | InChI=1S/C19H14Cl2N4OS/c20-10-6-7-11(12(21)9-10)17-16-13(3-1-4-14(16)26)22-19-23-18(24-25(17)19)15-5-2-8-27-15/h2,5-9,17H,1,3-4H2,(H,22,23,24) |
| InChIKey | RTMSUYWBSBIJJC-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.32 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |