C11H9N2O4S- — CID 135843621
2-[(5S)-2-(3-hydroxyphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetate (PubChem CID 135843621) has the molecular formula C11H9N2O4S- and a molecular weight of 265.27 g/mol. Its IUPAC name is 2-[(5S)-2-(3-hydroxyphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetate.
| Compound Name | 2-[(5S)-2-(3-hydroxyphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetate |
|---|---|
| PubChem CID | 135843621 |
| Molecular Formula | C11H9N2O4S- |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 2-[(5S)-2-(3-hydroxyphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetate |
| SMILES | O=C([O-])C[C@@H]1S/C(=N/c2cccc(O)c2)NC1=O |
| InChI | InChI=1S/C11H10N2O4S/c14-7-3-1-2-6(4-7)12-11-13-10(17)8(18-11)5-9(15)16/h1-4,8,14H,5H2,(H,15,16)(H,12,13,17)/p-1/t8-/m0/s1 |
| InChIKey | OKKFFWWAXGDCPA-QMMMGPOBSA-M |
| XLogP | -0.25 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|