C24H23FN6O3 — CID 135844011
[4-(4-fluorophenyl)piperazin-1-yl]-[5-methyl-7-(2-nitrophenyl)-4,7-dihydropyrazolo[1,5-a]pyrimidin-6-yl]methanone (PubChem CID 135844011) has the molecular formula C24H23FN6O3 and a molecular weight of 462.49 g/mol. Its IUPAC name is [4-(4-fluorophenyl)piperazin-1-yl]-[5-methyl-7-(2-nitrophenyl)-4,7-dihydropyrazolo[1,5-a]pyrimidin-6-yl]methanone.
| Compound Name | [4-(4-fluorophenyl)piperazin-1-yl]-[5-methyl-7-(2-nitrophenyl)-4,7-dihydropyrazolo[1,5-a]pyrimidin-6-yl]methanone |
|---|---|
| PubChem CID | 135844011 |
| Molecular Formula | C24H23FN6O3 |
| Molecular Weight | 462.49 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | [4-(4-fluorophenyl)piperazin-1-yl]-[5-methyl-7-(2-nitrophenyl)-4,7-dihydropyrazolo[1,5-a]pyrimidin-6-yl]methanone |
| SMILES | CC1=C(C(=O)N2CCN(c3ccc(F)cc3)CC2)C(c2ccccc2[N+](=O)[O-])n2nccc2N1 |
| InChI | InChI=1S/C24H23FN6O3/c1-16-22(24(32)29-14-12-28(13-15-29)18-8-6-17(25)7-9-18)23(30-21(27-16)10-11-26-30)19-4-2-3-5-20(19)31(33)34/h2-11,23,27H,12-15H2,1H3 |
| InChIKey | IUQHWRYJUFRFND-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 96.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.49 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|