C16H12Cl2FN5 — CID 135845518
(5R,7R)-5-(2,4-dichlorophenyl)-7-(3-fluorophenyl)-4,5,6,7-tetrahydrotetrazolo[1,5-a]pyrimidine (PubChem CID 135845518) has the molecular formula C16H12Cl2FN5 and a molecular weight of 364.21 g/mol. Its IUPAC name is (5R,7R)-5-(2,4-dichlorophenyl)-7-(3-fluorophenyl)-4,5,6,7-tetrahydrotetrazolo[1,5-a]pyrimidine.
| Compound Name | (5R,7R)-5-(2,4-dichlorophenyl)-7-(3-fluorophenyl)-4,5,6,7-tetrahydrotetrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 135845518 |
| Molecular Formula | C16H12Cl2FN5 |
| Molecular Weight | 364.21 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | (5R,7R)-5-(2,4-dichlorophenyl)-7-(3-fluorophenyl)-4,5,6,7-tetrahydrotetrazolo[1,5-a]pyrimidine |
| SMILES | Fc1cccc([C@H]2C[C@H](c3ccc(Cl)cc3Cl)Nc3nnnn32)c1 |
| InChI | InChI=1S/C16H12Cl2FN5/c17-10-4-5-12(13(18)7-10)14-8-15(9-2-1-3-11(19)6-9)24-16(20-14)21-22-23-24/h1-7,14-15H,8H2,(H,20,21,23)/t14-,15-/m1/s1 |
| InChIKey | IJTRGPMZGAZHBC-HUUCEWRRSA-N |
| XLogP | 4.27 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.21 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |