C18H18ClN5 — CID 136668162
(5R,7S)-7-(3-chlorophenyl)-5-(3,4-dimethylphenyl)-4,5,6,7-tetrahydrotetrazolo[1,5-a]pyrimidine (PubChem CID 136668162) has the molecular formula C18H18ClN5 and a molecular weight of 339.83 g/mol. Its IUPAC name is (5R,7S)-7-(3-chlorophenyl)-5-(3,4-dimethylphenyl)-4,5,6,7-tetrahydrotetrazolo[1,5-a]pyrimidine.
| Compound Name | (5R,7S)-7-(3-chlorophenyl)-5-(3,4-dimethylphenyl)-4,5,6,7-tetrahydrotetrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136668162 |
| Molecular Formula | C18H18ClN5 |
| Molecular Weight | 339.83 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | (5R,7S)-7-(3-chlorophenyl)-5-(3,4-dimethylphenyl)-4,5,6,7-tetrahydrotetrazolo[1,5-a]pyrimidine |
| SMILES | Cc1ccc([C@H]2C[C@@H](c3cccc(Cl)c3)n3nnnc3N2)cc1C |
| InChI | InChI=1S/C18H18ClN5/c1-11-6-7-13(8-12(11)2)16-10-17(14-4-3-5-15(19)9-14)24-18(20-16)21-22-23-24/h3-9,16-17H,10H2,1-2H3,(H,20,21,23)/t16-,17+/m1/s1 |
| InChIKey | GWQMUBOAGAWECO-SJORKVTESA-N |
| XLogP | 4.09 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.83 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |