C17H31NSi — CID 135850268
N-[dimethyl-(2,3,4,5-tetramethylcyclopenta-1,4-dien-1-yl)silyl]cyclohexanamine (PubChem CID 135850268) has the molecular formula C17H31NSi and a molecular weight of 277.53 g/mol. Its IUPAC name is N-[dimethyl-(2,3,4,5-tetramethylcyclopenta-1,4-dien-1-yl)silyl]cyclohexanamine.
| Compound Name | N-[dimethyl-(2,3,4,5-tetramethylcyclopenta-1,4-dien-1-yl)silyl]cyclohexanamine |
|---|---|
| PubChem CID | 135850268 |
| Molecular Formula | C17H31NSi |
| Molecular Weight | 277.53 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | N-[dimethyl-(2,3,4,5-tetramethylcyclopenta-1,4-dien-1-yl)silyl]cyclohexanamine |
| SMILES | CC1=C(C)C(C)C(C)=C1[Si](C)(C)NC1CCCCC1 |
| InChI | InChI=1S/C17H31NSi/c1-12-13(2)15(4)17(14(12)3)19(5,6)18-16-10-8-7-9-11-16/h12,16,18H,7-11H2,1-6H3 |
| InChIKey | BZXZPSIRKWWQIP-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|