C22H32NSi — CID 70306336
CID 70306336 (PubChem CID 70306336) has the molecular formula C22H32NSi and a molecular weight of 338.59 g/mol.
| Compound Name | CID 70306336 |
|---|---|
| PubChem CID | 70306336 |
| Molecular Formula | C22H32NSi |
| Molecular Weight | 338.59 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | — |
| SMILES | CC1=C(C)C(C)C([Si](NC2CCCCC2)c2ccccc2C)=C1C |
| InChI | InChI=1S/C22H32NSi/c1-15-11-9-10-14-21(15)24(23-20-12-7-6-8-13-20)22-18(4)16(2)17(3)19(22)5/h9-11,14,18,20,23H,6-8,12-13H2,1-5H3 |
| InChIKey | RIUHWWRSCWNVKP-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.59 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|